C23H21N5O5 — CID 135404679
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-nitro-4-piperidin-1-ylbenzoate (PubChem CID 135404679) has the molecular formula C23H21N5O5 and a molecular weight of 447.45 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-nitro-4-piperidin-1-ylbenzoate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-nitro-4-piperidin-1-ylbenzoate |
|---|---|
| PubChem CID | 135404679 |
| Molecular Formula | C23H21N5O5 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-nitro-4-piperidin-1-ylbenzoate |
| SMILES | N#C/C(=C(/O)COC(=O)c1ccc(N2CCCCC2)c([N+](=O)[O-])c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H21N5O5/c24-13-16(22-25-17-6-2-3-7-18(17)26-22)21(29)14-33-23(30)15-8-9-19(20(12-15)28(31)32)27-10-4-1-5-11-27/h2-3,6-9,12,29H,1,4-5,10-11,14H2,(H,25,26)/b21-16- |
| InChIKey | FKRWDCKQSYNUGL-PGMHBOJBSA-N |
| XLogP | 4.11 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|