C27H18N4O5 — CID 135466319
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 135466319) has the molecular formula C27H18N4O5 and a molecular weight of 478.46 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 135466319 |
| Molecular Formula | C27H18N4O5 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | N#C/C(=C(/O)COC(=O)c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C27H18N4O5/c28-13-20(24-29-21-8-4-5-9-22(21)30-24)23(32)15-36-27(35)17-10-11-18-19(12-17)26(34)31(25(18)33)14-16-6-2-1-3-7-16/h1-12,32H,14-15H2,(H,29,30)/b23-20- |
| InChIKey | KPKMMGBQIRJPIO-ATJXCDBQSA-N |
| XLogP | 4.01 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|