C28H20N4O5 — CID 135544688
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate (PubChem CID 135544688) has the molecular formula C28H20N4O5 and a molecular weight of 492.49 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 135544688 |
| Molecular Formula | C28H20N4O5 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoate |
| SMILES | N#C/C(=C(/O)COC(=O)C(Cc1ccccc1)N1C(=O)c2ccccc2C1=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C28H20N4O5/c29-15-20(25-30-21-12-6-7-13-22(21)31-25)24(33)16-37-28(36)23(14-17-8-2-1-3-9-17)32-26(34)18-10-4-5-11-19(18)27(32)35/h1-13,23,33H,14,16H2,(H,30,31)/b24-20- |
| InChIKey | NLSUULUEQLZFLF-GFMRDNFCSA-N |
| XLogP | 3.81 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|