C19H14FN3O3 — CID 135809742
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(3-fluorophenyl)acetate (PubChem CID 135809742) has the molecular formula C19H14FN3O3 and a molecular weight of 351.34 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(3-fluorophenyl)acetate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(3-fluorophenyl)acetate |
|---|---|
| PubChem CID | 135809742 |
| Molecular Formula | C19H14FN3O3 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(3-fluorophenyl)acetate |
| SMILES | N#C/C(=C(/O)COC(=O)Cc1cccc(F)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H14FN3O3/c20-13-5-3-4-12(8-13)9-18(25)26-11-17(24)14(10-21)19-22-15-6-1-2-7-16(15)23-19/h1-8,24H,9,11H2,(H,22,23)/b17-14- |
| InChIKey | JNHAYXYFRXGFQS-VKAVYKQESA-N |
| XLogP | 3.28 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|