C19H17N5O3S — CID 136793153
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate (PubChem CID 136793153) has the molecular formula C19H17N5O3S and a molecular weight of 395.44 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 136793153 |
| Molecular Formula | C19H17N5O3S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate |
| SMILES | Cc1cc(C)nc(SCC(=O)OCC(O)=C(C#N)c2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C19H17N5O3S/c1-11-7-12(2)22-19(21-11)28-10-17(26)27-9-16(25)13(8-20)18-23-14-5-3-4-6-15(14)24-18/h3-7,25H,9-10H2,1-2H3,(H,23,24) |
| InChIKey | BIOGHVGSGWYDIB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|