C20H18N6O5S — CID 135775931
ethyl 4-amino-2-[2-[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enoxy]-2-oxoethyl]sulfanylpyrimidine-5-carboxylate (PubChem CID 135775931) has the molecular formula C20H18N6O5S and a molecular weight of 454.47 g/mol. Its IUPAC name is ethyl 4-amino-2-[2-[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enoxy]-2-oxoethyl]sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[2-[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enoxy]-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 135775931 |
| Molecular Formula | C20H18N6O5S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | ethyl 4-amino-2-[2-[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enoxy]-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCC(=O)OC/C(O)=C(\C#N)c2nc3ccccc3[nH]2)nc1N |
| InChI | InChI=1S/C20H18N6O5S/c1-2-30-19(29)12-8-23-20(26-17(12)22)32-10-16(28)31-9-15(27)11(7-21)18-24-13-5-3-4-6-14(13)25-18/h3-6,8,27H,2,9-10H2,1H3,(H,24,25)(H2,22,23,26)/b15-11- |
| InChIKey | ZBCVHCRWAHRNSQ-PTNGSMBKSA-N |
| XLogP | 2.24 |
| TPSA | 177.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|