C19H13F2N3O3S — CID 135773614
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(2,5-difluorophenyl)sulfanylacetate (PubChem CID 135773614) has the molecular formula C19H13F2N3O3S and a molecular weight of 401.39 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(2,5-difluorophenyl)sulfanylacetate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(2,5-difluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 135773614 |
| Molecular Formula | C19H13F2N3O3S |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-(2,5-difluorophenyl)sulfanylacetate |
| SMILES | N#C/C(=C(/O)COC(=O)CSc1cc(F)ccc1F)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H13F2N3O3S/c20-11-5-6-13(21)17(7-11)28-10-18(26)27-9-16(25)12(8-22)19-23-14-3-1-2-4-15(14)24-19/h1-7,25H,9-10H2,(H,23,24)/b16-12- |
| InChIKey | QNLIVKVVQJLUTN-VBKFSLOCSA-N |
| XLogP | 3.97 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|