C20H15FN4O4 — CID 135916202
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-[(3-fluorobenzoyl)amino]acetate (PubChem CID 135916202) has the molecular formula C20H15FN4O4 and a molecular weight of 394.36 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-[(3-fluorobenzoyl)amino]acetate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-[(3-fluorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 135916202 |
| Molecular Formula | C20H15FN4O4 |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 2-[(3-fluorobenzoyl)amino]acetate |
| SMILES | N#CC(=C(O)COC(=O)CNC(=O)c1cccc(F)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H15FN4O4/c21-13-5-3-4-12(8-13)20(28)23-10-18(27)29-11-17(26)14(9-22)19-24-15-6-1-2-7-16(15)25-19/h1-8,26H,10-11H2,(H,23,28)(H,24,25) |
| InChIKey | POJMQSSQXKLTMF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|