C19H12F3N3O3 — CID 135719865
[(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-(trifluoromethyl)benzoate (PubChem CID 135719865) has the molecular formula C19H12F3N3O3 and a molecular weight of 387.32 g/mol. Its IUPAC name is [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 135719865 |
| Molecular Formula | C19H12F3N3O3 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | [(Z)-3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-(trifluoromethyl)benzoate |
| SMILES | N#C/C(=C(/O)COC(=O)c1cccc(C(F)(F)F)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H12F3N3O3/c20-19(21,22)12-5-3-4-11(8-12)18(27)28-10-16(26)13(9-23)17-24-14-6-1-2-7-15(14)25-17/h1-8,26H,10H2,(H,24,25)/b16-13- |
| InChIKey | HDMDNZXMUGZPDS-SSZFMOIBSA-N |
| XLogP | 4.23 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|