C21H17F3N4O5S — CID 3904142
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate (PubChem CID 3904142) has the molecular formula C21H17F3N4O5S and a molecular weight of 494.45 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 3904142 |
| Molecular Formula | C21H17F3N4O5S |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate |
| SMILES | N#CC(=C(O)COC(=O)CCNS(=O)(=O)c1cccc(C(F)(F)F)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H17F3N4O5S/c22-21(23,24)13-4-3-5-14(10-13)34(31,32)26-9-8-19(30)33-12-18(29)15(11-25)20-27-16-6-1-2-7-17(16)28-20/h1-7,10,26,29H,8-9,12H2,(H,27,28) |
| InChIKey | QZCGZIVILIMCHK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 145.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|