C17H15F4NO4S — CID 42965943
(4-fluorophenyl)methyl 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate (PubChem CID 42965943) has the molecular formula C17H15F4NO4S and a molecular weight of 405.37 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate.
| Compound Name | (4-fluorophenyl)methyl 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 42965943 |
| Molecular Formula | C17H15F4NO4S |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | (4-fluorophenyl)methyl 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate |
| SMILES | O=C(CCNS(=O)(=O)c1cccc(C(F)(F)F)c1)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H15F4NO4S/c18-14-6-4-12(5-7-14)11-26-16(23)8-9-22-27(24,25)15-3-1-2-13(10-15)17(19,20)21/h1-7,10,22H,8-9,11H2 |
| InChIKey | OKJVVYJTPTYMBR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |