C21H24F3NO4S — CID 23037560
ethyl 4-[4-[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]ethyl]phenyl]butanoate (PubChem CID 23037560) has the molecular formula C21H24F3NO4S and a molecular weight of 443.49 g/mol. Its IUPAC name is ethyl 4-[4-[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]ethyl]phenyl]butanoate.
| Compound Name | ethyl 4-[4-[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]ethyl]phenyl]butanoate |
|---|---|
| PubChem CID | 23037560 |
| Molecular Formula | C21H24F3NO4S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | ethyl 4-[4-[2-[[3-(trifluoromethyl)phenyl]sulfonylamino]ethyl]phenyl]butanoate |
| SMILES | CCOC(=O)CCCc1ccc(CCNS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C21H24F3NO4S/c1-2-29-20(26)8-3-5-16-9-11-17(12-10-16)13-14-25-30(27,28)19-7-4-6-18(15-19)21(22,23)24/h4,6-7,9-12,15,25H,2-3,5,8,13-14H2,1H3 |
| InChIKey | MSLFEXCJHZZCAX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |