C12H13F3O4S — CID 43174233
ethyl 3-[3-(trifluoromethyl)phenyl]sulfonylpropanoate (PubChem CID 43174233) has the molecular formula C12H13F3O4S and a molecular weight of 310.29 g/mol. Its IUPAC name is ethyl 3-[3-(trifluoromethyl)phenyl]sulfonylpropanoate.
| Compound Name | ethyl 3-[3-(trifluoromethyl)phenyl]sulfonylpropanoate |
|---|---|
| PubChem CID | 43174233 |
| Molecular Formula | C12H13F3O4S |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | ethyl 3-[3-(trifluoromethyl)phenyl]sulfonylpropanoate |
| SMILES | CCOC(=O)CCS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3O4S/c1-2-19-11(16)6-7-20(17,18)10-5-3-4-9(8-10)12(13,14)15/h3-5,8H,2,6-7H2,1H3 |
| InChIKey | JYIWYJCMZWVXJG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |