C16H19F3O4S — CID 123587350
ethyl 4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexane-1-carboxylate (PubChem CID 123587350) has the molecular formula C16H19F3O4S and a molecular weight of 364.39 g/mol. Its IUPAC name is ethyl 4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123587350 |
| Molecular Formula | C16H19F3O4S |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | ethyl 4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H19F3O4S/c1-2-23-15(20)11-6-8-13(9-7-11)24(21,22)14-5-3-4-12(10-14)16(17,18)19/h3-5,10-11,13H,2,6-9H2,1H3 |
| InChIKey | OAGDTGDNIWWYBS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |