C18H20F3N3O3S — CID 140596113
2-[[4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl]methyl]pyrazole-3-carboxamide (PubChem CID 140596113) has the molecular formula C18H20F3N3O3S and a molecular weight of 415.44 g/mol. Its IUPAC name is 2-[[4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl]methyl]pyrazole-3-carboxamide.
| Compound Name | 2-[[4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 140596113 |
| Molecular Formula | C18H20F3N3O3S |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-[[4-[3-(trifluoromethyl)phenyl]sulfonylcyclohexyl]methyl]pyrazole-3-carboxamide |
| SMILES | NC(=O)c1ccnn1CC1CCC(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H20F3N3O3S/c19-18(20,21)13-2-1-3-15(10-13)28(26,27)14-6-4-12(5-7-14)11-24-16(17(22)25)8-9-23-24/h1-3,8-10,12,14H,4-7,11H2,(H2,22,25) |
| InChIKey | RHPXNXNKUNFQLI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |