C17H25ClF3N3O2S — CID 119929378
1-(piperidin-4-ylmethyl)-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride (PubChem CID 119929378) has the molecular formula C17H25ClF3N3O2S and a molecular weight of 427.92 g/mol. Its IUPAC name is 1-(piperidin-4-ylmethyl)-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride.
| Compound Name | 1-(piperidin-4-ylmethyl)-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 119929378 |
| Molecular Formula | C17H25ClF3N3O2S |
| Molecular Weight | 427.92 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 1-(piperidin-4-ylmethyl)-4-[3-(trifluoromethyl)phenyl]sulfonylpiperazine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cccc(C(F)(F)F)c1)N1CCN(CC2CCNCC2)CC1 |
| InChI | InChI=1S/C17H24F3N3O2S.ClH/c18-17(19,20)15-2-1-3-16(12-15)26(24,25)23-10-8-22(9-11-23)13-14-4-6-21-7-5-14;/h1-3,12,14,21H,4-11,13H2;1H |
| InChIKey | YTSXQYXITTYSEQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.92 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |