C13H17F3N3O3S+ — CID 8748449
2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 8748449) has the molecular formula C13H17F3N3O3S+ and a molecular weight of 352.36 g/mol. Its IUPAC name is 2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | 2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8748449 |
| Molecular Formula | C13H17F3N3O3S+ |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | NC(=O)C[NH+]1CCN(S(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C13H16F3N3O3S/c14-13(15,16)10-2-1-3-11(8-10)23(21,22)19-6-4-18(5-7-19)9-12(17)20/h1-3,8H,4-7,9H2,(H2,17,20)/p+1 |
| InChIKey | FSMSJNYPVLNPCC-UHFFFAOYSA-O |
| XLogP | -0.92 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |