C13H16F3NO5S — CID 43050757
2-methoxyethyl 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate (PubChem CID 43050757) has the molecular formula C13H16F3NO5S and a molecular weight of 355.33 g/mol. Its IUPAC name is 2-methoxyethyl 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate.
| Compound Name | 2-methoxyethyl 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 43050757 |
| Molecular Formula | C13H16F3NO5S |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 2-methoxyethyl 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate |
| SMILES | COCCOC(=O)CCNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO5S/c1-21-7-8-22-12(18)5-6-17-23(19,20)11-4-2-3-10(9-11)13(14,15)16/h2-4,9,17H,5-8H2,1H3 |
| InChIKey | KASUVGPZIPITGX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|