C19H19F3N2O5S — CID 42969305
(1-anilino-1-oxopropan-2-yl) 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate (PubChem CID 42969305) has the molecular formula C19H19F3N2O5S and a molecular weight of 444.43 g/mol. Its IUPAC name is (1-anilino-1-oxopropan-2-yl) 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate.
| Compound Name | (1-anilino-1-oxopropan-2-yl) 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 42969305 |
| Molecular Formula | C19H19F3N2O5S |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | (1-anilino-1-oxopropan-2-yl) 3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propanoate |
| SMILES | CC(OC(=O)CCNS(=O)(=O)c1cccc(C(F)(F)F)c1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H19F3N2O5S/c1-13(18(26)24-15-7-3-2-4-8-15)29-17(25)10-11-23-30(27,28)16-9-5-6-14(12-16)19(20,21)22/h2-9,12-13,23H,10-11H2,1H3,(H,24,26) |
| InChIKey | RATJKGMSVNJWDR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |