C18H18F3NO5S — CID 7982933
2-(4-methylphenoxy)ethyl 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate (PubChem CID 7982933) has the molecular formula C18H18F3NO5S and a molecular weight of 417.41 g/mol. Its IUPAC name is 2-(4-methylphenoxy)ethyl 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate.
| Compound Name | 2-(4-methylphenoxy)ethyl 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 7982933 |
| Molecular Formula | C18H18F3NO5S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-(4-methylphenoxy)ethyl 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate |
| SMILES | Cc1ccc(OCCOC(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H18F3NO5S/c1-13-5-7-15(8-6-13)26-9-10-27-17(23)12-22-28(24,25)16-4-2-3-14(11-16)18(19,20)21/h2-8,11,22H,9-10,12H2,1H3 |
| InChIKey | OGZVZRZSDNFROK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|