C14H16F3N5O4S — CID 55399245
(1-propyltetrazol-5-yl)methyl 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate (PubChem CID 55399245) has the molecular formula C14H16F3N5O4S and a molecular weight of 407.37 g/mol. Its IUPAC name is (1-propyltetrazol-5-yl)methyl 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate.
| Compound Name | (1-propyltetrazol-5-yl)methyl 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 55399245 |
| Molecular Formula | C14H16F3N5O4S |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | (1-propyltetrazol-5-yl)methyl 2-[[3-(trifluoromethyl)phenyl]sulfonylamino]acetate |
| SMILES | CCCn1nnnc1COC(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3N5O4S/c1-2-6-22-12(19-20-21-22)9-26-13(23)8-18-27(24,25)11-5-3-4-10(7-11)14(15,16)17/h3-5,7,18H,2,6,8-9H2,1H3 |
| InChIKey | JVIKPTITWQGHNB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |