C15H19N5O5S — CID 55401533
(1-propyltetrazol-5-yl)methyl 2-[(4-acetylphenyl)sulfonylamino]acetate (PubChem CID 55401533) has the molecular formula C15H19N5O5S and a molecular weight of 381.41 g/mol. Its IUPAC name is (1-propyltetrazol-5-yl)methyl 2-[(4-acetylphenyl)sulfonylamino]acetate.
| Compound Name | (1-propyltetrazol-5-yl)methyl 2-[(4-acetylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 55401533 |
| Molecular Formula | C15H19N5O5S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | (1-propyltetrazol-5-yl)methyl 2-[(4-acetylphenyl)sulfonylamino]acetate |
| SMILES | CCCn1nnnc1COC(=O)CNS(=O)(=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C15H19N5O5S/c1-3-8-20-14(17-18-19-20)10-25-15(22)9-16-26(23,24)13-6-4-12(5-7-13)11(2)21/h4-7,16H,3,8-10H2,1-2H3 |
| InChIKey | AKRNYPVQELJPOF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |