About (1-propyltetrazol-5-yl)methyl 2-phenoxyacetate
(1-propyltetrazol-5-yl)methyl 2-phenoxyacetate (PubChem CID 55397419) has the molecular formula C13H16N4O3
and a molecular weight of 276.30 g/mol. Its IUPAC name is (1-propyltetrazol-5-yl)methyl 2-phenoxyacetate.
Molecular Properties
| Compound Name | (1-propyltetrazol-5-yl)methyl 2-phenoxyacetate |
| PubChem CID | 55397419 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (1-propyltetrazol-5-yl)methyl 2-phenoxyacetate |
| SMILES | CCCn1nnnc1COC(=O)COc1ccccc1 |
| InChI | InChI=1S/C13H16N4O3/c1-2-8-17-12(14-15-16-17)9-20-13(18)10-19-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3 |
| InChIKey | CFFLNKVWQMJGFR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (1-propyltetrazol-5-yl)methyl 2-phenoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-propyltetrazol-5-yl)methyl 2-phenoxyacetate?
The IUPAC name of (1-propyltetrazol-5-yl)methyl 2-phenoxyacetate (CID 55397419) is (1-propyltetrazol-5-yl)methyl 2-phenoxyacetate.
What is the SMILES notation for (1-propyltetrazol-5-yl)methyl 2-phenoxyacetate?
The canonical SMILES for (1-propyltetrazol-5-yl)methyl 2-phenoxyacetate is CCCn1nnnc1COC(=O)COc1ccccc1.
What is the InChIKey of (1-propyltetrazol-5-yl)methyl 2-phenoxyacetate?
The InChIKey is CFFLNKVWQMJGFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O3/c1-2-8-17-12(14-15-16-17)9-20-13(18)10-19-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3.
What are the key properties of (1-propyltetrazol-5-yl)methyl 2-phenoxyacetate?
(1-propyltetrazol-5-yl)methyl 2-phenoxyacetate has a molecular weight of 276.30 g/mol, XLogP of 1.21, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-propyltetrazol-5-yl)methyl 2-phenoxyacetate is sourced from PubChem (CID 55397419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).