C15H20N4O3 — CID 55400541
(1-propyltetrazol-5-yl)methyl 2-(2,6-dimethylphenoxy)acetate (PubChem CID 55400541) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is (1-propyltetrazol-5-yl)methyl 2-(2,6-dimethylphenoxy)acetate.
| Compound Name | (1-propyltetrazol-5-yl)methyl 2-(2,6-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 55400541 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (1-propyltetrazol-5-yl)methyl 2-(2,6-dimethylphenoxy)acetate |
| SMILES | CCCn1nnnc1COC(=O)COc1c(C)cccc1C |
| InChI | InChI=1S/C15H20N4O3/c1-4-8-19-13(16-17-18-19)9-21-14(20)10-22-15-11(2)6-5-7-12(15)3/h5-7H,4,8-10H2,1-3H3 |
| InChIKey | UFXGFEWXEUKMJY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |