C15H20N4O2 — CID 55399432
(1-propyltetrazol-5-yl)methyl 2,4,6-trimethylbenzoate (PubChem CID 55399432) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is (1-propyltetrazol-5-yl)methyl 2,4,6-trimethylbenzoate.
| Compound Name | (1-propyltetrazol-5-yl)methyl 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 55399432 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (1-propyltetrazol-5-yl)methyl 2,4,6-trimethylbenzoate |
| SMILES | CCCn1nnnc1COC(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H20N4O2/c1-5-6-19-13(16-17-18-19)9-21-15(20)14-11(3)7-10(2)8-12(14)4/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | HEDQPMNXSCFBFN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |