C13H15FN4O2 — CID 55472995
(1-propyltetrazol-5-yl)methyl 5-fluoro-2-methylbenzoate (PubChem CID 55472995) has the molecular formula C13H15FN4O2 and a molecular weight of 278.29 g/mol. Its IUPAC name is (1-propyltetrazol-5-yl)methyl 5-fluoro-2-methylbenzoate.
| Compound Name | (1-propyltetrazol-5-yl)methyl 5-fluoro-2-methylbenzoate |
|---|---|
| PubChem CID | 55472995 |
| Molecular Formula | C13H15FN4O2 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (1-propyltetrazol-5-yl)methyl 5-fluoro-2-methylbenzoate |
| SMILES | CCCn1nnnc1COC(=O)c1cc(F)ccc1C |
| InChI | InChI=1S/C13H15FN4O2/c1-3-6-18-12(15-16-17-18)8-20-13(19)11-7-10(14)5-4-9(11)2/h4-5,7H,3,6,8H2,1-2H3 |
| InChIKey | XUEUQTIIIZTJMJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |