C17H17FN6O2 — CID 27027535
(1-propyltetrazol-5-yl)methyl 2-(2-fluoroanilino)pyridine-3-carboxylate (PubChem CID 27027535) has the molecular formula C17H17FN6O2 and a molecular weight of 356.36 g/mol. Its IUPAC name is (1-propyltetrazol-5-yl)methyl 2-(2-fluoroanilino)pyridine-3-carboxylate.
| Compound Name | (1-propyltetrazol-5-yl)methyl 2-(2-fluoroanilino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 27027535 |
| Molecular Formula | C17H17FN6O2 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (1-propyltetrazol-5-yl)methyl 2-(2-fluoroanilino)pyridine-3-carboxylate |
| SMILES | CCCn1nnnc1COC(=O)c1cccnc1Nc1ccccc1F |
| InChI | InChI=1S/C17H17FN6O2/c1-2-10-24-15(21-22-23-24)11-26-17(25)12-6-5-9-19-16(12)20-14-8-4-3-7-13(14)18/h3-9H,2,10-11H2,1H3,(H,19,20) |
| InChIKey | YIVPFOFRLRWZPM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |