C17H17N5O4 — CID 8578938
(1-propyltetrazol-5-yl)methyl 2-(furan-2-carbonylamino)benzoate (PubChem CID 8578938) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is (1-propyltetrazol-5-yl)methyl 2-(furan-2-carbonylamino)benzoate.
| Compound Name | (1-propyltetrazol-5-yl)methyl 2-(furan-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 8578938 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (1-propyltetrazol-5-yl)methyl 2-(furan-2-carbonylamino)benzoate |
| SMILES | CCCn1nnnc1COC(=O)c1ccccc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C17H17N5O4/c1-2-9-22-15(19-20-21-22)11-26-17(24)12-6-3-4-7-13(12)18-16(23)14-8-5-10-25-14/h3-8,10H,2,9,11H2,1H3,(H,18,23) |
| InChIKey | LDIIOENRNIJZSU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |