C20H16FNO5 — CID 9139702
2-(2-fluorophenoxy)ethyl 2-(furan-2-carbonylamino)benzoate (PubChem CID 9139702) has the molecular formula C20H16FNO5 and a molecular weight of 369.35 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl 2-(furan-2-carbonylamino)benzoate.
| Compound Name | 2-(2-fluorophenoxy)ethyl 2-(furan-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 9139702 |
| Molecular Formula | C20H16FNO5 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl 2-(furan-2-carbonylamino)benzoate |
| SMILES | O=C(Nc1ccccc1C(=O)OCCOc1ccccc1F)c1ccco1 |
| InChI | InChI=1S/C20H16FNO5/c21-15-7-2-4-9-17(15)26-12-13-27-20(24)14-6-1-3-8-16(14)22-19(23)18-10-5-11-25-18/h1-11H,12-13H2,(H,22,23) |
| InChIKey | AGNWDMWXASNCCF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|