C25H24FNO5 — CID 18285361
2-(2-fluorophenoxy)ethyl 2-[3-(4-methoxyphenyl)propanoylamino]benzoate (PubChem CID 18285361) has the molecular formula C25H24FNO5 and a molecular weight of 437.47 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl 2-[3-(4-methoxyphenyl)propanoylamino]benzoate.
| Compound Name | 2-(2-fluorophenoxy)ethyl 2-[3-(4-methoxyphenyl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 18285361 |
| Molecular Formula | C25H24FNO5 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl 2-[3-(4-methoxyphenyl)propanoylamino]benzoate |
| SMILES | COc1ccc(CCC(=O)Nc2ccccc2C(=O)OCCOc2ccccc2F)cc1 |
| InChI | InChI=1S/C25H24FNO5/c1-30-19-13-10-18(11-14-19)12-15-24(28)27-22-8-4-2-6-20(22)25(29)32-17-16-31-23-9-5-3-7-21(23)26/h2-11,13-14H,12,15-17H2,1H3,(H,27,28) |
| InChIKey | JSCJVJTZANGVCG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|