C20H15FN2O3 — CID 41030181
phenacyl 2-(2-fluoroanilino)pyridine-3-carboxylate (PubChem CID 41030181) has the molecular formula C20H15FN2O3 and a molecular weight of 350.35 g/mol. Its IUPAC name is phenacyl 2-(2-fluoroanilino)pyridine-3-carboxylate.
| Compound Name | phenacyl 2-(2-fluoroanilino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 41030181 |
| Molecular Formula | C20H15FN2O3 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | phenacyl 2-(2-fluoroanilino)pyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1cccnc1Nc1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C20H15FN2O3/c21-16-10-4-5-11-17(16)23-19-15(9-6-12-22-19)20(25)26-13-18(24)14-7-2-1-3-8-14/h1-12H,13H2,(H,22,23) |
| InChIKey | SDLFSSAJEPLMTC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |