C18H20N6O3 — CID 27027534
(1-propyltetrazol-5-yl)methyl 2-(2-methoxyanilino)pyridine-3-carboxylate (PubChem CID 27027534) has the molecular formula C18H20N6O3 and a molecular weight of 368.40 g/mol. Its IUPAC name is (1-propyltetrazol-5-yl)methyl 2-(2-methoxyanilino)pyridine-3-carboxylate.
| Compound Name | (1-propyltetrazol-5-yl)methyl 2-(2-methoxyanilino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 27027534 |
| Molecular Formula | C18H20N6O3 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (1-propyltetrazol-5-yl)methyl 2-(2-methoxyanilino)pyridine-3-carboxylate |
| SMILES | CCCn1nnnc1COC(=O)c1cccnc1Nc1ccccc1OC |
| InChI | InChI=1S/C18H20N6O3/c1-3-11-24-16(21-22-23-24)12-27-18(25)13-7-6-10-19-17(13)20-14-8-4-5-9-15(14)26-2/h4-10H,3,11-12H2,1-2H3,(H,19,20) |
| InChIKey | NLMXHYZUXXNNIA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |