C20H16N4O4 — CID 9019943
(1-propyltetrazol-5-yl)methyl 9,10-dioxoanthracene-1-carboxylate (PubChem CID 9019943) has the molecular formula C20H16N4O4 and a molecular weight of 376.37 g/mol. Its IUPAC name is (1-propyltetrazol-5-yl)methyl 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | (1-propyltetrazol-5-yl)methyl 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 9019943 |
| Molecular Formula | C20H16N4O4 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (1-propyltetrazol-5-yl)methyl 9,10-dioxoanthracene-1-carboxylate |
| SMILES | CCCn1nnnc1COC(=O)c1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H16N4O4/c1-2-10-24-16(21-22-23-24)11-28-20(27)15-9-5-8-14-17(15)19(26)13-7-4-3-6-12(13)18(14)25/h3-9H,2,10-11H2,1H3 |
| InChIKey | JPOINFKGPCFPBQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 104.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|