C14H19N5O2 — CID 55397232
(1-propyltetrazol-5-yl)methyl 3-(dimethylamino)benzoate (PubChem CID 55397232) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is (1-propyltetrazol-5-yl)methyl 3-(dimethylamino)benzoate.
| Compound Name | (1-propyltetrazol-5-yl)methyl 3-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 55397232 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (1-propyltetrazol-5-yl)methyl 3-(dimethylamino)benzoate |
| SMILES | CCCn1nnnc1COC(=O)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C14H19N5O2/c1-4-8-19-13(15-16-17-19)10-21-14(20)11-6-5-7-12(9-11)18(2)3/h5-7,9H,4,8,10H2,1-3H3 |
| InChIKey | BTEAGWRZXXXTLF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |