C15H21N5O4S — CID 30764204
(1-butyltetrazol-5-yl)methyl 3-(ethylsulfamoyl)benzoate (PubChem CID 30764204) has the molecular formula C15H21N5O4S and a molecular weight of 367.43 g/mol. Its IUPAC name is (1-butyltetrazol-5-yl)methyl 3-(ethylsulfamoyl)benzoate.
| Compound Name | (1-butyltetrazol-5-yl)methyl 3-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 30764204 |
| Molecular Formula | C15H21N5O4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (1-butyltetrazol-5-yl)methyl 3-(ethylsulfamoyl)benzoate |
| SMILES | CCCCn1nnnc1COC(=O)c1cccc(S(=O)(=O)NCC)c1 |
| InChI | InChI=1S/C15H21N5O4S/c1-3-5-9-20-14(17-18-19-20)11-24-15(21)12-7-6-8-13(10-12)25(22,23)16-4-2/h6-8,10,16H,3-5,9,11H2,1-2H3 |
| InChIKey | LEAYARVVICQJBI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |