C15H15ClN2O4S — CID 30749513
(6-chloro-3-pyridinyl)methyl 3-(ethylsulfamoyl)benzoate (PubChem CID 30749513) has the molecular formula C15H15ClN2O4S and a molecular weight of 354.82 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl 3-(ethylsulfamoyl)benzoate.
| Compound Name | (6-chloro-3-pyridinyl)methyl 3-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 30749513 |
| Molecular Formula | C15H15ClN2O4S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl 3-(ethylsulfamoyl)benzoate |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)OCc2ccc(Cl)nc2)c1 |
| InChI | InChI=1S/C15H15ClN2O4S/c1-2-18-23(20,21)13-5-3-4-12(8-13)15(19)22-10-11-6-7-14(16)17-9-11/h3-9,18H,2,10H2,1H3 |
| InChIKey | JCGKNUHNELHJJU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|