C21H24N4O4S2 — CID 30137212
(3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 3-(ethylsulfamoyl)benzoate (PubChem CID 30137212) has the molecular formula C21H24N4O4S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 3-(ethylsulfamoyl)benzoate.
| Compound Name | (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 3-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 30137212 |
| Molecular Formula | C21H24N4O4S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 3-(ethylsulfamoyl)benzoate |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)OCc2nc(N)c3c4c(sc3n2)CCCCC4)c1 |
| InChI | InChI=1S/C21H24N4O4S2/c1-2-23-31(27,28)14-8-6-7-13(11-14)21(26)29-12-17-24-19(22)18-15-9-4-3-5-10-16(15)30-20(18)25-17/h6-8,11,23H,2-5,9-10,12H2,1H3,(H2,22,24,25) |
| InChIKey | JBBJHLVFFKTLPK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |