C19H18N4O4S — CID 33356242
(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl 2-methyl-6-nitrobenzoate (PubChem CID 33356242) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is (4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl 2-methyl-6-nitrobenzoate.
| Compound Name | (4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl 2-methyl-6-nitrobenzoate |
|---|---|
| PubChem CID | 33356242 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl 2-methyl-6-nitrobenzoate |
| SMILES | Cc1cccc([N+](=O)[O-])c1C(=O)OCc1nc(N)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C19H18N4O4S/c1-10-5-4-7-12(23(25)26)15(10)19(24)27-9-14-21-17(20)16-11-6-2-3-8-13(11)28-18(16)22-14/h4-5,7H,2-3,6,8-9H2,1H3,(H2,20,21,22) |
| InChIKey | PVCSWXSYKMRWOC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|