C22H26N4O4S2 — CID 46658019
(3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 2-[methyl-(4-methylphenyl)sulfonylamino]acetate (PubChem CID 46658019) has the molecular formula C22H26N4O4S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 2-[methyl-(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 2-[methyl-(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 46658019 |
| Molecular Formula | C22H26N4O4S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 2-[methyl-(4-methylphenyl)sulfonylamino]acetate |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(=O)OCc2nc(N)c3c4c(sc3n2)CCCCC4)cc1 |
| InChI | InChI=1S/C22H26N4O4S2/c1-14-8-10-15(11-9-14)32(28,29)26(2)12-19(27)30-13-18-24-21(23)20-16-6-4-3-5-7-17(16)31-22(20)25-18/h8-11H,3-7,12-13H2,1-2H3,(H2,23,24,25) |
| InChIKey | JHVOAFJHAWVYQV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |