C19H19N3O3S — CID 25315948
(3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 3-hydroxybenzoate (PubChem CID 25315948) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 3-hydroxybenzoate.
| Compound Name | (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 3-hydroxybenzoate |
|---|---|
| PubChem CID | 25315948 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (3-amino-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-5-yl)methyl 3-hydroxybenzoate |
| SMILES | Nc1nc(COC(=O)c2cccc(O)c2)nc2sc3c(c12)CCCCC3 |
| InChI | InChI=1S/C19H19N3O3S/c20-17-16-13-7-2-1-3-8-14(13)26-18(16)22-15(21-17)10-25-19(24)11-5-4-6-12(23)9-11/h4-6,9,23H,1-3,7-8,10H2,(H2,20,21,22) |
| InChIKey | QZPHNNRFYKHWHJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |