C19H18N4O5S — CID 27925429
(4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl 2-methoxy-5-nitrobenzoate (PubChem CID 27925429) has the molecular formula C19H18N4O5S and a molecular weight of 414.44 g/mol. Its IUPAC name is (4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl 2-methoxy-5-nitrobenzoate.
| Compound Name | (4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl 2-methoxy-5-nitrobenzoate |
|---|---|
| PubChem CID | 27925429 |
| Molecular Formula | C19H18N4O5S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)methyl 2-methoxy-5-nitrobenzoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)OCc1nc(N)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C19H18N4O5S/c1-27-13-7-6-10(23(25)26)8-12(13)19(24)28-9-15-21-17(20)16-11-4-2-3-5-14(11)29-18(16)22-15/h6-8H,2-5,9H2,1H3,(H2,20,21,22) |
| InChIKey | WCQVFFMLMJQBHS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|