C14H14N2O5S — CID 35629358
(2-ethyl-1,3-thiazol-4-yl)methyl 2-methoxy-5-nitrobenzoate (PubChem CID 35629358) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is (2-ethyl-1,3-thiazol-4-yl)methyl 2-methoxy-5-nitrobenzoate.
| Compound Name | (2-ethyl-1,3-thiazol-4-yl)methyl 2-methoxy-5-nitrobenzoate |
|---|---|
| PubChem CID | 35629358 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | (2-ethyl-1,3-thiazol-4-yl)methyl 2-methoxy-5-nitrobenzoate |
| SMILES | CCc1nc(COC(=O)c2cc([N+](=O)[O-])ccc2OC)cs1 |
| InChI | InChI=1S/C14H14N2O5S/c1-3-13-15-9(8-22-13)7-21-14(17)11-6-10(16(18)19)4-5-12(11)20-2/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | NZFDZRJPJSPGBM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|