C17H12ClN3O6 — CID 45352497
(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-methoxy-5-nitrobenzoate (PubChem CID 45352497) has the molecular formula C17H12ClN3O6 and a molecular weight of 389.75 g/mol. Its IUPAC name is (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-methoxy-5-nitrobenzoate.
| Compound Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-methoxy-5-nitrobenzoate |
|---|---|
| PubChem CID | 45352497 |
| Molecular Formula | C17H12ClN3O6 |
| Molecular Weight | 389.75 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-methoxy-5-nitrobenzoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)OCc1cc(=O)n2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C17H12ClN3O6/c1-26-14-4-3-12(21(24)25)7-13(14)17(23)27-9-11-6-16(22)20-8-10(18)2-5-15(20)19-11/h2-8H,9H2,1H3 |
| InChIKey | JGAOMIXVKPOYEQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.75 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|