C22H15ClN4O5 — CID 46610956
(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-anilino-3-nitrobenzoate (PubChem CID 46610956) has the molecular formula C22H15ClN4O5 and a molecular weight of 450.84 g/mol. Its IUPAC name is (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-anilino-3-nitrobenzoate.
| Compound Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-anilino-3-nitrobenzoate |
|---|---|
| PubChem CID | 46610956 |
| Molecular Formula | C22H15ClN4O5 |
| Molecular Weight | 450.84 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-anilino-3-nitrobenzoate |
| SMILES | O=C(OCc1cc(=O)n2cc(Cl)ccc2n1)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H15ClN4O5/c23-15-7-9-20-25-17(11-21(28)26(20)12-15)13-32-22(29)14-6-8-18(19(10-14)27(30)31)24-16-4-2-1-3-5-16/h1-12,24H,13H2 |
| InChIKey | VBPXRPYXBYUBMQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.84 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|