C22H21ClN4O6 — CID 55354866
(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 55354866) has the molecular formula C22H21ClN4O6 and a molecular weight of 472.89 g/mol. Its IUPAC name is (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55354866 |
| Molecular Formula | C22H21ClN4O6 |
| Molecular Weight | 472.89 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | Cc1ccc2nc(COC(=O)C(NC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)C(C)C)cc(=O)n2c1 |
| InChI | InChI=1S/C22H21ClN4O6/c1-12(2)20(25-21(29)14-5-6-16(23)17(8-14)27(31)32)22(30)33-11-15-9-19(28)26-10-13(3)4-7-18(26)24-15/h4-10,12,20H,11H2,1-3H3,(H,25,29) |
| InChIKey | IMKNGKVTTDEVDF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.89 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|