C16H17ClF3N3O6 — CID 55306858
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate (PubChem CID 55306858) has the molecular formula C16H17ClF3N3O6 and a molecular weight of 439.77 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55306858 |
| Molecular Formula | C16H17ClF3N3O6 |
| Molecular Weight | 439.77 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2-[(4-chloro-3-nitrobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)OCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C16H17ClF3N3O6/c1-8(2)13(15(26)29-6-12(24)21-7-16(18,19)20)22-14(25)9-3-4-10(17)11(5-9)23(27)28/h3-5,8,13H,6-7H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | XWVJCEZHDDSNTF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.77 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|