C18H16Cl3N3O4 — CID 60617148
4-chloro-N-[(2S)-1-(2,5-dichloroanilino)-3-methyl-1-oxobutan-2-yl]-3-nitrobenzamide (PubChem CID 60617148) has the molecular formula C18H16Cl3N3O4 and a molecular weight of 444.70 g/mol. Its IUPAC name is 4-chloro-N-[(2S)-1-(2,5-dichloroanilino)-3-methyl-1-oxobutan-2-yl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[(2S)-1-(2,5-dichloroanilino)-3-methyl-1-oxobutan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 60617148 |
| Molecular Formula | C18H16Cl3N3O4 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | 4-chloro-N-[(2S)-1-(2,5-dichloroanilino)-3-methyl-1-oxobutan-2-yl]-3-nitrobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H16Cl3N3O4/c1-9(2)16(18(26)22-14-8-11(19)4-6-12(14)20)23-17(25)10-3-5-13(21)15(7-10)24(27)28/h3-9,16H,1-2H3,(H,22,26)(H,23,25)/t16-/m0/s1 |
| InChIKey | NTDWBWDDAPTMNQ-INIZCTEOSA-N |
| XLogP | 4.95 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|