C20H20Cl2N4O5 — CID 55915698
N-[1-(5-acetamido-2-chloroanilino)-3-methyl-1-oxobutan-2-yl]-4-chloro-3-nitrobenzamide (PubChem CID 55915698) has the molecular formula C20H20Cl2N4O5 and a molecular weight of 467.31 g/mol. Its IUPAC name is N-[1-(5-acetamido-2-chloroanilino)-3-methyl-1-oxobutan-2-yl]-4-chloro-3-nitrobenzamide.
| Compound Name | N-[1-(5-acetamido-2-chloroanilino)-3-methyl-1-oxobutan-2-yl]-4-chloro-3-nitrobenzamide |
|---|---|
| PubChem CID | 55915698 |
| Molecular Formula | C20H20Cl2N4O5 |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | N-[1-(5-acetamido-2-chloroanilino)-3-methyl-1-oxobutan-2-yl]-4-chloro-3-nitrobenzamide |
| SMILES | CC(=O)Nc1ccc(Cl)c(NC(=O)C(NC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)C(C)C)c1 |
| InChI | InChI=1S/C20H20Cl2N4O5/c1-10(2)18(25-19(28)12-4-6-15(22)17(8-12)26(30)31)20(29)24-16-9-13(23-11(3)27)5-7-14(16)21/h4-10,18H,1-3H3,(H,23,27)(H,24,29)(H,25,28) |
| InChIKey | ONYAGHILVLUILU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|