C23H25ClN4O5 — CID 24657544
4-chloro-N-[3-methyl-1-oxo-1-[4-(pyrrolidine-1-carbonyl)anilino]butan-2-yl]-3-nitrobenzamide (PubChem CID 24657544) has the molecular formula C23H25ClN4O5 and a molecular weight of 472.93 g/mol. Its IUPAC name is 4-chloro-N-[3-methyl-1-oxo-1-[4-(pyrrolidine-1-carbonyl)anilino]butan-2-yl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[3-methyl-1-oxo-1-[4-(pyrrolidine-1-carbonyl)anilino]butan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 24657544 |
| Molecular Formula | C23H25ClN4O5 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 4-chloro-N-[3-methyl-1-oxo-1-[4-(pyrrolidine-1-carbonyl)anilino]butan-2-yl]-3-nitrobenzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)Nc1ccc(C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C23H25ClN4O5/c1-14(2)20(26-21(29)16-7-10-18(24)19(13-16)28(32)33)22(30)25-17-8-5-15(6-9-17)23(31)27-11-3-4-12-27/h5-10,13-14,20H,3-4,11-12H2,1-2H3,(H,25,30)(H,26,29) |
| InChIKey | ZZXCYOPUBNJBPZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|