C16H14ClN3O4 — CID 9138292
N-[(2S)-1-anilino-1-oxopropan-2-yl]-4-chloro-3-nitrobenzamide (PubChem CID 9138292) has the molecular formula C16H14ClN3O4 and a molecular weight of 347.76 g/mol. Its IUPAC name is N-[(2S)-1-anilino-1-oxopropan-2-yl]-4-chloro-3-nitrobenzamide.
| Compound Name | N-[(2S)-1-anilino-1-oxopropan-2-yl]-4-chloro-3-nitrobenzamide |
|---|---|
| PubChem CID | 9138292 |
| Molecular Formula | C16H14ClN3O4 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-[(2S)-1-anilino-1-oxopropan-2-yl]-4-chloro-3-nitrobenzamide |
| SMILES | C[C@H](NC(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H14ClN3O4/c1-10(15(21)19-12-5-3-2-4-6-12)18-16(22)11-7-8-13(17)14(9-11)20(23)24/h2-10H,1H3,(H,18,22)(H,19,21)/t10-/m0/s1 |
| InChIKey | LQIIWBKGLYDBNI-JTQLQIEISA-N |
| XLogP | 3.01 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|